C21H15NO4S — CID 2482716
(2-phenyl-1,3-thiazol-4-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 2482716) has the molecular formula C21H15NO4S and a molecular weight of 377.42 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2482716 |
| Molecular Formula | C21H15NO4S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C21H15NO4S/c23-18-10-17(19(24)16-9-5-4-8-15(16)18)21(25)26-11-14-12-27-20(22-14)13-6-2-1-3-7-13/h1-10,12,23-24H,11H2 |
| InChIKey | VEKDMHTYTVBHPI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|