C20H14N2O3S — CID 2387635
(2-phenyl-1,3-thiazol-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2387635) has the molecular formula C20H14N2O3S and a molecular weight of 362.41 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2387635 |
| Molecular Formula | C20H14N2O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H14N2O3S/c23-18-10-16(15-8-4-5-9-17(15)22-18)20(24)25-11-14-12-26-19(21-14)13-6-2-1-3-7-13/h1-10,12H,11H2,(H,22,23) |
| InChIKey | HICUCXPOHHWEPA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |