C17H12F2N2O2S — CID 16612092
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-amino-4-fluorobenzoate (PubChem CID 16612092) has the molecular formula C17H12F2N2O2S and a molecular weight of 346.36 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-amino-4-fluorobenzoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 16612092 |
| Molecular Formula | C17H12F2N2O2S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H12F2N2O2S/c18-11-3-1-10(2-4-11)16-21-13(9-24-16)8-23-17(22)14-6-5-12(19)7-15(14)20/h1-7,9H,8,20H2 |
| InChIKey | ZMJRTVOBAQBQMQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|