C15H9FN2O4S2 — CID 9364403
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate (PubChem CID 9364403) has the molecular formula C15H9FN2O4S2 and a molecular weight of 364.38 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 9364403 |
| Molecular Formula | C15H9FN2O4S2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccc(F)cc2)n1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C15H9FN2O4S2/c16-10-3-1-9(2-4-10)14-17-11(8-23-14)7-22-15(19)12-5-6-13(24-12)18(20)21/h1-6,8H,7H2 |
| InChIKey | XKGFFXDUYJZDOR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|