C17H14FNO3S2 — CID 51327833
2-(4-fluorophenyl)-4-[(4-methylsulfonylphenoxy)methyl]-1,3-thiazole (PubChem CID 51327833) has the molecular formula C17H14FNO3S2 and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[(4-methylsulfonylphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-(4-fluorophenyl)-4-[(4-methylsulfonylphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 51327833 |
| Molecular Formula | C17H14FNO3S2 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[(4-methylsulfonylphenoxy)methyl]-1,3-thiazole |
| SMILES | CS(=O)(=O)c1ccc(OCc2csc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H14FNO3S2/c1-24(20,21)16-8-6-15(7-9-16)22-10-14-11-23-17(19-14)12-2-4-13(18)5-3-12/h2-9,11H,10H2,1H3 |
| InChIKey | JJAPGOHCUZSGEP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |