C18H15NO2S — CID 32758569
4-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methoxy]benzaldehyde (PubChem CID 32758569) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methoxy]benzaldehyde.
| Compound Name | 4-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 32758569 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methoxy]benzaldehyde |
| SMILES | Cc1ccc(-c2nc(COc3ccc(C=O)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H15NO2S/c1-13-2-6-15(7-3-13)18-19-16(12-22-18)11-21-17-8-4-14(10-20)5-9-17/h2-10,12H,11H2,1H3 |
| InChIKey | DRJBJEBYBUYZSO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|