C24H21NO2S — CID 18956566
1-[4-[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]phenyl]ethanol (PubChem CID 18956566) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-[4-[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]phenyl]ethanol.
| Compound Name | 1-[4-[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 18956566 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[4-[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]phenyl]ethanol |
| SMILES | CC(O)c1ccc(-c2ccc(OCc3csc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C24H21NO2S/c1-17(26)18-7-9-19(10-8-18)20-11-13-23(14-12-20)27-15-22-16-28-24(25-22)21-5-3-2-4-6-21/h2-14,16-17,26H,15H2,1H3 |
| InChIKey | VODAJJVFJSSWLR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |