C24H18NO3S- — CID 7745304
2-[2-[4-[(4-phenylphenoxy)methyl]phenyl]-1,3-thiazol-4-yl]acetate (PubChem CID 7745304) has the molecular formula C24H18NO3S- and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[2-[4-[(4-phenylphenoxy)methyl]phenyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[4-[(4-phenylphenoxy)methyl]phenyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7745304 |
| Molecular Formula | C24H18NO3S- |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-[2-[4-[(4-phenylphenoxy)methyl]phenyl]-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(-c2ccc(COc3ccc(-c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C24H19NO3S/c26-23(27)14-21-16-29-24(25-21)20-8-6-17(7-9-20)15-28-22-12-10-19(11-13-22)18-4-2-1-3-5-18/h1-13,16H,14-15H2,(H,26,27)/p-1 |
| InChIKey | AAOYGQIDIIXTKM-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |