C20H19NO4S — CID 51297612
3-methoxy-4-[[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]methoxy]benzaldehyde (PubChem CID 51297612) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-methoxy-4-[[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]methoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 51297612 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-methoxy-4-[[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]methoxy]benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCc1csc(COc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H19NO4S/c1-14-3-6-17(7-4-14)24-12-20-21-16(13-26-20)11-25-18-8-5-15(10-22)9-19(18)23-2/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | CKGXQLOQQPYJKM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|