C19H16N2O4S — CID 60564920
methyl 4-[[2-(4-carbamoylphenyl)-1,3-thiazol-4-yl]methoxy]benzoate (PubChem CID 60564920) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl 4-[[2-(4-carbamoylphenyl)-1,3-thiazol-4-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[2-(4-carbamoylphenyl)-1,3-thiazol-4-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 60564920 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | methyl 4-[[2-(4-carbamoylphenyl)-1,3-thiazol-4-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2csc(-c3ccc(C(N)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C19H16N2O4S/c1-24-19(23)14-6-8-16(9-7-14)25-10-15-11-26-18(21-15)13-4-2-12(3-5-13)17(20)22/h2-9,11H,10H2,1H3,(H2,20,22) |
| InChIKey | WJZLMZSTRKGJNU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |