C20H16FNO3S — CID 7861532
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 7861532) has the molecular formula C20H16FNO3S and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7861532 |
| Molecular Formula | C20H16FNO3S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCc2csc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H16FNO3S/c1-24-18-9-2-14(3-10-18)4-11-19(23)25-12-17-13-26-20(22-17)15-5-7-16(21)8-6-15/h2-11,13H,12H2,1H3/b11-4+ |
| InChIKey | XBLKYLUXDSPCOA-NYYWCZLTSA-N |
| XLogP | 4.71 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|