C18H13F2NO3S2 — CID 8848881
(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 8848881) has the molecular formula C18H13F2NO3S2 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8848881 |
| Molecular Formula | C18H13F2NO3S2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)OCc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C18H13F2NO3S2/c19-18(20)24-15-4-1-12(2-5-15)3-6-16(22)23-9-14-11-26-17(21-14)13-7-8-25-10-13/h1-8,10-11,18H,9H2/b6-3+ |
| InChIKey | DYJKCWBZFGBAKA-ZZXKWVIFSA-N |
| XLogP | 5.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|