C17H12F2N2O4S — CID 8636716
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 8636716) has the molecular formula C17H12F2N2O4S and a molecular weight of 378.36 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8636716 |
| Molecular Formula | C17H12F2N2O4S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)OCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C17H12F2N2O4S/c18-17(19)24-13-4-1-11(2-5-13)3-6-15(22)23-9-14-20-16(21-25-14)12-7-8-26-10-12/h1-8,10,17H,9H2/b6-3+ |
| InChIKey | GZRUUTOMTQAHLZ-ZZXKWVIFSA-N |
| XLogP | 4.16 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|