C17H12F2N2O5 — CID 7996471
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996471) has the molecular formula C17H12F2N2O5 and a molecular weight of 362.29 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996471 |
| Molecular Formula | C17H12F2N2O5 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)OCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C17H12F2N2O5/c18-17(19)25-12-6-3-11(4-7-12)5-8-15(22)24-10-14-20-21-16(26-14)13-2-1-9-23-13/h1-9,17H,10H2/b8-5+ |
| InChIKey | GCCNCFHOEGISKW-VMPITWQZSA-N |
| XLogP | 3.69 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|