C16H10BrFN2O4 — CID 7972028
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 7972028) has the molecular formula C16H10BrFN2O4 and a molecular weight of 393.17 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7972028 |
| Molecular Formula | C16H10BrFN2O4 |
| Molecular Weight | 393.17 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)OCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C16H10BrFN2O4/c17-11-4-5-12(18)10(8-11)3-6-15(21)23-9-14-19-20-16(24-14)13-2-1-7-22-13/h1-8H,9H2/b6-3+ |
| InChIKey | NADOJJDNKCYWPM-ZZXKWVIFSA-N |
| XLogP | 3.99 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|