C12H10BrFN2O4 — CID 7650697
[2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 7650697) has the molecular formula C12H10BrFN2O4 and a molecular weight of 345.12 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7650697 |
| Molecular Formula | C12H10BrFN2O4 |
| Molecular Weight | 345.12 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | NC(=O)NC(=O)COC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H10BrFN2O4/c13-8-2-3-9(14)7(5-8)1-4-11(18)20-6-10(17)16-12(15)19/h1-5H,6H2,(H3,15,16,17,19)/b4-1+ |
| InChIKey | PNDUTRRCAAJYPQ-DAFODLJHSA-N |
| XLogP | 1.34 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.12 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|