C19H15BrFNO3 — CID 7650782
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 7650782) has the molecular formula C19H15BrFNO3 and a molecular weight of 404.24 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7650782 |
| Molecular Formula | C19H15BrFNO3 |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H15BrFNO3/c20-15-6-7-16(21)14(11-15)5-8-19(24)25-12-18(23)22-10-9-13-3-1-2-4-17(13)22/h1-8,11H,9-10,12H2/b8-5+ |
| InChIKey | GNONIARWBAAPER-VMPITWQZSA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|