C20H18BrNO3 — CID 7808503
[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 7808503) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7808503 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(Br)c1)OCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H18BrNO3/c21-17-8-3-5-15(13-17)10-11-20(24)25-14-19(23)22-12-4-7-16-6-1-2-9-18(16)22/h1-3,5-6,8-11,13H,4,7,12,14H2/b11-10+ |
| InChIKey | FWCJKVSVBQSQSM-ZHACJKMWSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|