C22H18ClNO3S — CID 7721380
[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721380) has the molecular formula C22H18ClNO3S and a molecular weight of 411.91 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721380 |
| Molecular Formula | C22H18ClNO3S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1sc2ccccc2c1Cl)OCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H18ClNO3S/c23-22-16-8-2-4-10-18(16)28-19(22)11-12-21(26)27-14-20(25)24-13-5-7-15-6-1-3-9-17(15)24/h1-4,6,8-12H,5,7,13-14H2/b12-11+ |
| InChIKey | YOLNUCSGZHZUQS-VAWYXSNFSA-N |
| XLogP | 5.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|