C22H20ClN3O3S — CID 5120803
3-chloro-N'-[4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanoyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 5120803) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 3-chloro-N'-[4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanoyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanoyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 5120803 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 3-chloro-N'-[4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanoyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(CCC(=O)N1CCCc2ccccc21)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H20ClN3O3S/c23-20-15-8-2-4-10-17(15)30-21(20)22(29)25-24-18(27)11-12-19(28)26-13-5-7-14-6-1-3-9-16(14)26/h1-4,6,8-10H,5,7,11-13H2,(H,24,27)(H,25,29) |
| InChIKey | PEUIMQCFQSYASD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|