C18H12BrClO2S — CID 7721545
(2-bromophenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721545) has the molecular formula C18H12BrClO2S and a molecular weight of 407.72 g/mol. Its IUPAC name is (2-bromophenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | (2-bromophenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721545 |
| Molecular Formula | C18H12BrClO2S |
| Molecular Weight | 407.72 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | (2-bromophenyl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1sc2ccccc2c1Cl)OCc1ccccc1Br |
| InChI | InChI=1S/C18H12BrClO2S/c19-14-7-3-1-5-12(14)11-22-17(21)10-9-16-18(20)13-6-2-4-8-15(13)23-16/h1-10H,11H2/b10-9+ |
| InChIKey | BQFPKBNTBNAURR-MDZDMXLPSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.72 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|