C18H11ClN2O3S2 — CID 7721476
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721476) has the molecular formula C18H11ClN2O3S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721476 |
| Molecular Formula | C18H11ClN2O3S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1sc2ccccc2c1Cl)OCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C18H11ClN2O3S2/c19-17-12-3-1-2-4-13(12)26-14(17)5-6-16(23)24-10-11-9-15(22)21-7-8-25-18(21)20-11/h1-9H,10H2/b6-5+ |
| InChIKey | RHCYZBHCODERKL-AATRIKPKSA-N |
| XLogP | 4.38 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|