C13H8ClN3O3S — CID 2653786
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-chloropyridine-3-carboxylate (PubChem CID 2653786) has the molecular formula C13H8ClN3O3S and a molecular weight of 321.75 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-chloropyridine-3-carboxylate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2653786 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2ccsc2n1)c1cccnc1Cl |
| InChI | InChI=1S/C13H8ClN3O3S/c14-11-9(2-1-3-15-11)12(19)20-7-8-6-10(18)17-4-5-21-13(17)16-8/h1-6H,7H2 |
| InChIKey | ISQRXISUSIJDJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|