C14H9IN2O3S — CID 3585239
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-iodobenzoate (PubChem CID 3585239) has the molecular formula C14H9IN2O3S and a molecular weight of 412.21 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-iodobenzoate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-iodobenzoate |
|---|---|
| PubChem CID | 3585239 |
| Molecular Formula | C14H9IN2O3S |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-iodobenzoate |
| SMILES | O=C(OCc1cc(=O)n2ccsc2n1)c1cccc(I)c1 |
| InChI | InChI=1S/C14H9IN2O3S/c15-10-3-1-2-9(6-10)13(19)20-8-11-7-12(18)17-4-5-21-14(17)16-11/h1-7H,8H2 |
| InChIKey | OHIWBECBULHVCO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|