C15H11N3O5S — CID 2659443
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-methyl-4-nitrobenzoate (PubChem CID 2659443) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-methyl-4-nitrobenzoate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 2659443 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCc2cc(=O)n3ccsc3n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N3O5S/c1-9-6-10(2-3-12(9)18(21)22)14(20)23-8-11-7-13(19)17-4-5-24-15(17)16-11/h2-7H,8H2,1H3 |
| InChIKey | DTUOORGGAXQTFW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|