C20H17N3O3S — CID 7274928
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 7274928) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 7274928 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)OCc2cc(=O)n3ccsc3n2)cc1 |
| InChI | InChI=1S/C20H17N3O3S/c1-13-3-4-14(2)23(13)17-7-5-15(6-8-17)19(25)26-12-16-11-18(24)22-9-10-27-20(22)21-16/h3-11H,12H2,1-2H3 |
| InChIKey | IPEJQJZTBCPMRD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|