C15H11N3O5S2 — CID 7361738
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7361738) has the molecular formula C15H11N3O5S2 and a molecular weight of 377.40 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7361738 |
| Molecular Formula | C15H11N3O5S2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCc2cc(=O)n3ccsc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N3O5S2/c1-24-12-3-2-9(6-11(12)18(21)22)14(20)23-8-10-7-13(19)17-4-5-25-15(17)16-10/h2-7H,8H2,1H3 |
| InChIKey | YRCLXZJSTYEHKJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|