C17H12N6O5S2 — CID 2604025
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2604025) has the molecular formula C17H12N6O5S2 and a molecular weight of 444.45 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2604025 |
| Molecular Formula | C17H12N6O5S2 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCc2cc(=O)n3ccsc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N6O5S2/c1-21-9-18-20-17(21)30-13-3-2-10(6-12(13)23(26)27)15(25)28-8-11-7-14(24)22-4-5-29-16(22)19-11/h2-7,9H,8H2,1H3 |
| InChIKey | DSUYVTIJLQCODP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 134.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|