C21H16N6O5S2 — CID 2371429
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2371429) has the molecular formula C21H16N6O5S2 and a molecular weight of 496.53 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2371429 |
| Molecular Formula | C21H16N6O5S2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCC(=O)Nc2nc(-c3ccccc3)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N6O5S2/c1-26-12-22-25-21(26)34-17-8-7-14(9-16(17)27(30)31)19(29)32-10-18(28)24-20-23-15(11-33-20)13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3,(H,23,24,28) |
| InChIKey | GSUYIVKUAUIHTK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|