C20H15N5O4S2 — CID 2082955
(2-phenyl-1,3-thiazol-4-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2082955) has the molecular formula C20H15N5O4S2 and a molecular weight of 453.51 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2082955 |
| Molecular Formula | C20H15N5O4S2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCc2csc(-c3ccccc3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15N5O4S2/c1-24-12-21-23-20(24)31-17-8-7-14(9-16(17)25(27)28)19(26)29-10-15-11-30-18(22-15)13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3 |
| InChIKey | AJEJLSVQPGLBOV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|