C21H14N6O5S2 — CID 4830525
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 4830525) has the molecular formula C21H14N6O5S2 and a molecular weight of 494.51 g/mol. Its IUPAC name is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 4830525 |
| Molecular Formula | C21H14N6O5S2 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCc2cc(=O)n3c(n2)sc2ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14N6O5S2/c1-25-11-22-24-21(25)34-17-7-6-12(8-15(17)27(30)31)19(29)32-10-13-9-18(28)26-14-4-2-3-5-16(14)33-20(26)23-13/h2-9,11H,10H2,1H3 |
| InChIKey | SVLGHTMAPZXTHR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 134.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|