C18H11N3O5S — CID 2376027
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-nitrobenzoate (PubChem CID 2376027) has the molecular formula C18H11N3O5S and a molecular weight of 381.37 g/mol. Its IUPAC name is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-nitrobenzoate.
| Compound Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 2376027 |
| Molecular Formula | C18H11N3O5S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-nitrobenzoate |
| SMILES | O=C(OCc1cc(=O)n2c(n1)sc1ccccc12)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H11N3O5S/c22-16-9-12(19-18-20(16)14-6-1-2-7-15(14)27-18)10-26-17(23)11-4-3-5-13(8-11)21(24)25/h1-9H,10H2 |
| InChIKey | BNUFDKMAKKTYLA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|