C20H13FN2O3S — CID 42900956
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 42900956) has the molecular formula C20H13FN2O3S and a molecular weight of 380.40 g/mol. Its IUPAC name is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42900956 |
| Molecular Formula | C20H13FN2O3S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(F)c1)OCc1cc(=O)n2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C20H13FN2O3S/c21-14-5-3-4-13(10-14)8-9-19(25)26-12-15-11-18(24)23-16-6-1-2-7-17(16)27-20(23)22-15/h1-11H,12H2/b9-8+ |
| InChIKey | SWWHELXVKJNALL-CMDGGOBGSA-N |
| XLogP | 3.80 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|