C23H19ClN2O5S — CID 71954343
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 71954343) has the molecular formula C23H19ClN2O5S and a molecular weight of 470.93 g/mol. Its IUPAC name is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71954343 |
| Molecular Formula | C23H19ClN2O5S |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(C=CC(=O)OCc2cc(=O)n3c(n2)sc2ccccc23)cc(Cl)c1OC |
| InChI | InChI=1S/C23H19ClN2O5S/c1-3-30-18-11-14(10-16(24)22(18)29-2)8-9-21(28)31-13-15-12-20(27)26-17-6-4-5-7-19(17)32-23(26)25-15/h4-12H,3,13H2,1-2H3 |
| InChIKey | DZNNOPDBGRJKKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|