C20H20Cl2O4 — CID 7254552
[(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 7254552) has the molecular formula C20H20Cl2O4 and a molecular weight of 395.28 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7254552 |
| Molecular Formula | C20H20Cl2O4 |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)O[C@H](C)c2ccccc2Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C20H20Cl2O4/c1-4-25-18-12-14(11-17(22)20(18)24-3)9-10-19(23)26-13(2)15-7-5-6-8-16(15)21/h5-13H,4H2,1-3H3/b10-9+/t13-/m1/s1 |
| InChIKey | GLTPLRVQLRILBF-WTNCMQEWSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|