C19H19ClO4 — CID 7757565
[(1S)-1-phenylethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7757565) has the molecular formula C19H19ClO4 and a molecular weight of 346.81 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1S)-1-phenylethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7757565 |
| Molecular Formula | C19H19ClO4 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [(1S)-1-phenylethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)c2ccccc2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H19ClO4/c1-13(15-7-5-4-6-8-15)24-18(21)10-9-14-11-16(20)19(23-3)17(12-14)22-2/h4-13H,1-3H3/b10-9+/t13-/m0/s1 |
| InChIKey | NMYKTNWPFVHEDH-LXKVQUBZSA-N |
| XLogP | 4.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|