About 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid)
1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) (PubChem CID 174981518) has the molecular formula C35H32O6
and a molecular weight of 548.64 g/mol. Its IUPAC name is 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid).
Molecular Properties
| Compound Name | 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) |
| PubChem CID | 174981518 |
| Molecular Formula | C35H32O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) |
| SMILES | CC(OC(=O)C=Cc1ccccc1)c1ccccc1.O=C(O)C=Cc1ccccc1.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H16O2.2C9H8O2/c1-14(16-10-6-3-7-11-16)19-17(18)13-12-15-8-4-2-5-9-15;2*10-9(11)7-6-8-4-2-1-3-5-8/h2-14H,1H3;2*1-7H,(H,10,11) |
| InChIKey | MLHJHWQKMODUJI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid)?
The IUPAC name of 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) (CID 174981518) is 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid).
What is the SMILES notation for 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid)?
The canonical SMILES for 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) is CC(OC(=O)C=Cc1ccccc1)c1ccccc1.O=C(O)C=Cc1ccccc1.O=C(O)C=Cc1ccccc1.
What is the InChIKey of 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid)?
The InChIKey is MLHJHWQKMODUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2.2C9H8O2/c1-14(16-10-6-3-7-11-16)19-17(18)13-12-15-8-4-2-5-9-15;2*10-9(11)7-6-8-4-2-1-3-5-8/h2-14H,1H3;2*1-7H,(H,10,11).
What are the key properties of 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid)?
1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) has a molecular weight of 548.64 g/mol, XLogP of 7.57, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 3-phenylprop-2-enoate;bis(3-phenylprop-2-enoic acid) is sourced from PubChem (CID 174981518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).