About bis((E)-3-phenylprop-2-enoic acid);zinc
bis((E)-3-phenylprop-2-enoic acid);zinc (PubChem CID 11291345) has the molecular formula C18H16O4Zn
and a molecular weight of 361.71 g/mol. Its IUPAC name is bis((E)-3-phenylprop-2-enoic acid);zinc.
Molecular Properties
| Compound Name | bis((E)-3-phenylprop-2-enoic acid);zinc |
| PubChem CID | 11291345 |
| Molecular Formula | C18H16O4Zn |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | bis((E)-3-phenylprop-2-enoic acid);zinc |
| SMILES | O=C(O)/C=C/c1ccccc1.O=C(O)/C=C/c1ccccc1.[Zn] |
| InChI | InChI=1S/2C9H8O2.Zn/c2*10-9(11)7-6-8-4-2-1-3-5-8;/h2*1-7H,(H,10,11);/b2*7-6+; |
| InChIKey | HWDBKXIXVVZMDX-RWUXNGIBSA-N |
| XLogP | 3.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-3-phenylprop-2-enoic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-3-phenylprop-2-enoic acid);zinc?
The IUPAC name of bis((E)-3-phenylprop-2-enoic acid);zinc (CID 11291345) is bis((E)-3-phenylprop-2-enoic acid);zinc.
What is the SMILES notation for bis((E)-3-phenylprop-2-enoic acid);zinc?
The canonical SMILES for bis((E)-3-phenylprop-2-enoic acid);zinc is O=C(O)/C=C/c1ccccc1.O=C(O)/C=C/c1ccccc1.[Zn].
What is the InChIKey of bis((E)-3-phenylprop-2-enoic acid);zinc?
The InChIKey is HWDBKXIXVVZMDX-RWUXNGIBSA-N. The full InChI is InChI=1S/2C9H8O2.Zn/c2*10-9(11)7-6-8-4-2-1-3-5-8;/h2*1-7H,(H,10,11);/b2*7-6+;.
What are the key properties of bis((E)-3-phenylprop-2-enoic acid);zinc?
bis((E)-3-phenylprop-2-enoic acid);zinc has a molecular weight of 361.71 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-3-phenylprop-2-enoic acid);zinc is sourced from PubChem (CID 11291345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).