About CID 131855579
CID 131855579 (PubChem CID 131855579) has the molecular formula C18H16CaO4
and a molecular weight of 336.40 g/mol.
Molecular Properties
| Compound Name | CID 131855579 |
| PubChem CID | 131855579 |
| Molecular Formula | C18H16CaO4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | — |
| SMILES | O=C(O)C=Cc1ccccc1.O=C(O)C=Cc1ccccc1.[Ca] |
| InChI | InChI=1S/2C9H8O2.Ca/c2*10-9(11)7-6-8-4-2-1-3-5-8;/h2*1-7H,(H,10,11); |
| InChIKey | NBEZHJQBFKAZAH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 131855579 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131855579?
The IUPAC name of CID 131855579 (CID 131855579) is not available.
What is the SMILES notation for CID 131855579?
The canonical SMILES for CID 131855579 is O=C(O)C=Cc1ccccc1.O=C(O)C=Cc1ccccc1.[Ca].
What is the InChIKey of CID 131855579?
The InChIKey is NBEZHJQBFKAZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H8O2.Ca/c2*10-9(11)7-6-8-4-2-1-3-5-8;/h2*1-7H,(H,10,11);.
What are the key properties of CID 131855579?
CID 131855579 has a molecular weight of 336.40 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131855579 is sourced from PubChem (CID 131855579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).