About azane;3-phenylprop-2-enoic acid
azane;3-phenylprop-2-enoic acid (PubChem CID 66894546) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is azane;3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | azane;3-phenylprop-2-enoic acid |
| PubChem CID | 66894546 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | azane;3-phenylprop-2-enoic acid |
| SMILES | N.N.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H8O2.2H3N/c10-9(11)7-6-8-4-2-1-3-5-8;;/h1-7H,(H,10,11);2*1H3 |
| InChIKey | CAGXLQSSSINXDX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-phenylprop-2-enoic acid?
The IUPAC name of azane;3-phenylprop-2-enoic acid (CID 66894546) is azane;3-phenylprop-2-enoic acid.
What is the SMILES notation for azane;3-phenylprop-2-enoic acid?
The canonical SMILES for azane;3-phenylprop-2-enoic acid is N.N.O=C(O)C=Cc1ccccc1.
What is the InChIKey of azane;3-phenylprop-2-enoic acid?
The InChIKey is CAGXLQSSSINXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.2H3N/c10-9(11)7-6-8-4-2-1-3-5-8;;/h1-7H,(H,10,11);2*1H3.
What are the key properties of azane;3-phenylprop-2-enoic acid?
azane;3-phenylprop-2-enoic acid has a molecular weight of 182.22 g/mol, XLogP of 2.11, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-phenylprop-2-enoic acid is sourced from PubChem (CID 66894546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).