About ethane;methanamine;(E)-3-phenylprop-2-enoic acid
ethane;methanamine;(E)-3-phenylprop-2-enoic acid (PubChem CID 142207731) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;methanamine;(E)-3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethane;methanamine;(E)-3-phenylprop-2-enoic acid |
| PubChem CID | 142207731 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethane;methanamine;(E)-3-phenylprop-2-enoic acid |
| SMILES | CC.CN.O=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O2.C2H6.CH5N/c10-9(11)7-6-8-4-2-1-3-5-8;2*1-2/h1-7H,(H,10,11);1-2H3;2H2,1H3/b7-6+;; |
| InChIKey | VAILDUCUHNOUAQ-KMXZHCNGSA-N |
| XLogP | 2.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanamine;(E)-3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;(E)-3-phenylprop-2-enoic acid?
The IUPAC name of ethane;methanamine;(E)-3-phenylprop-2-enoic acid (CID 142207731) is ethane;methanamine;(E)-3-phenylprop-2-enoic acid.
What is the SMILES notation for ethane;methanamine;(E)-3-phenylprop-2-enoic acid?
The canonical SMILES for ethane;methanamine;(E)-3-phenylprop-2-enoic acid is CC.CN.O=C(O)/C=C/c1ccccc1.
What is the InChIKey of ethane;methanamine;(E)-3-phenylprop-2-enoic acid?
The InChIKey is VAILDUCUHNOUAQ-KMXZHCNGSA-N. The full InChI is InChI=1S/C9H8O2.C2H6.CH5N/c10-9(11)7-6-8-4-2-1-3-5-8;2*1-2/h1-7H,(H,10,11);1-2H3;2H2,1H3/b7-6+;;.
What are the key properties of ethane;methanamine;(E)-3-phenylprop-2-enoic acid?
ethane;methanamine;(E)-3-phenylprop-2-enoic acid has a molecular weight of 209.29 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;(E)-3-phenylprop-2-enoic acid is sourced from PubChem (CID 142207731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).