About 3-phenylprop-2-enoic acid;hydrobromide
3-phenylprop-2-enoic acid;hydrobromide (PubChem CID 172826551) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 3-phenylprop-2-enoic acid;hydrobromide.
Molecular Properties
| Compound Name | 3-phenylprop-2-enoic acid;hydrobromide |
| PubChem CID | 172826551 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 3-phenylprop-2-enoic acid;hydrobromide |
| SMILES | Br.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H8O2.BrH/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-7H,(H,10,11);1H |
| InChIKey | UYBUEVDLUUDYES-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-enoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enoic acid;hydrobromide?
The IUPAC name of 3-phenylprop-2-enoic acid;hydrobromide (CID 172826551) is 3-phenylprop-2-enoic acid;hydrobromide.
What is the SMILES notation for 3-phenylprop-2-enoic acid;hydrobromide?
The canonical SMILES for 3-phenylprop-2-enoic acid;hydrobromide is Br.O=C(O)C=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enoic acid;hydrobromide?
The InChIKey is UYBUEVDLUUDYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.BrH/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-7H,(H,10,11);1H.
What are the key properties of 3-phenylprop-2-enoic acid;hydrobromide?
3-phenylprop-2-enoic acid;hydrobromide has a molecular weight of 229.07 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enoic acid;hydrobromide is sourced from PubChem (CID 172826551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).