About diphenylmethanone;(E)-3-phenylprop-2-enoic acid
diphenylmethanone;(E)-3-phenylprop-2-enoic acid (PubChem CID 70019468) has the molecular formula C22H18O3
and a molecular weight of 330.38 g/mol. Its IUPAC name is diphenylmethanone;(E)-3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | diphenylmethanone;(E)-3-phenylprop-2-enoic acid |
| PubChem CID | 70019468 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | diphenylmethanone;(E)-3-phenylprop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C9H8O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;10-9(11)7-6-8-4-2-1-3-5-8/h1-10H;1-7H,(H,10,11)/b;7-6+ |
| InChIKey | YJFGZUSWWCQXPR-UETGHTDLSA-N |
| XLogP | 4.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;(E)-3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;(E)-3-phenylprop-2-enoic acid?
The IUPAC name of diphenylmethanone;(E)-3-phenylprop-2-enoic acid (CID 70019468) is diphenylmethanone;(E)-3-phenylprop-2-enoic acid.
What is the SMILES notation for diphenylmethanone;(E)-3-phenylprop-2-enoic acid?
The canonical SMILES for diphenylmethanone;(E)-3-phenylprop-2-enoic acid is O=C(O)/C=C/c1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;(E)-3-phenylprop-2-enoic acid?
The InChIKey is YJFGZUSWWCQXPR-UETGHTDLSA-N. The full InChI is InChI=1S/C13H10O.C9H8O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;10-9(11)7-6-8-4-2-1-3-5-8/h1-10H;1-7H,(H,10,11)/b;7-6+.
What are the key properties of diphenylmethanone;(E)-3-phenylprop-2-enoic acid?
diphenylmethanone;(E)-3-phenylprop-2-enoic acid has a molecular weight of 330.38 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;(E)-3-phenylprop-2-enoic acid is sourced from PubChem (CID 70019468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).