C31H22O3 — CID 101166440
(1E,4E)-1,5-bis(4-benzoylphenyl)penta-1,4-dien-3-one (PubChem CID 101166440) has the molecular formula C31H22O3 and a molecular weight of 442.51 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(4-benzoylphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(4-benzoylphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 101166440 |
| Molecular Formula | C31H22O3 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (1E,4E)-1,5-bis(4-benzoylphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccc(C(=O)c2ccccc2)cc1)/C=C/c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H22O3/c32-29(21-15-23-11-17-27(18-12-23)30(33)25-7-3-1-4-8-25)22-16-24-13-19-28(20-14-24)31(34)26-9-5-2-6-10-26/h1-22H/b21-15+,22-16+ |
| InChIKey | DQFQVIDODWHNPH-YHARCJFQSA-N |
| XLogP | 6.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|