C51H42O3 — CID 157206787
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one (PubChem CID 157206787) has the molecular formula C51H42O3 and a molecular weight of 702.89 g/mol. Its IUPAC name is (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 157206787 |
| Molecular Formula | C51H42O3 |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/3C17H14O/c3*18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h3*1-14H/b3*13-11+,14-12+ |
| InChIKey | ARLHFRNCWXUIEK-KOTRZWKBSA-N |
| XLogP | 11.95 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|