C17H15ClO — CID 70139846
1,5-diphenylpenta-1,4-dien-3-one;hydrochloride (PubChem CID 70139846) has the molecular formula C17H15ClO and a molecular weight of 270.76 g/mol. Its IUPAC name is 1,5-diphenylpenta-1,4-dien-3-one;hydrochloride.
| Compound Name | 1,5-diphenylpenta-1,4-dien-3-one;hydrochloride |
|---|---|
| PubChem CID | 70139846 |
| Molecular Formula | C17H15ClO |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1,5-diphenylpenta-1,4-dien-3-one;hydrochloride |
| SMILES | Cl.O=C(C=Cc1ccccc1)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H14O.ClH/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h1-14H;1H |
| InChIKey | CAAQBRKOAURIKO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|