C35H29OP — CID 87515115
(1Z,4E)-1,5-diphenylpenta-1,4-dien-3-one;triphenylphosphane (PubChem CID 87515115) has the molecular formula C35H29OP and a molecular weight of 496.59 g/mol. Its IUPAC name is (1Z,4E)-1,5-diphenylpenta-1,4-dien-3-one;triphenylphosphane.
| Compound Name | (1Z,4E)-1,5-diphenylpenta-1,4-dien-3-one;triphenylphosphane |
|---|---|
| PubChem CID | 87515115 |
| Molecular Formula | C35H29OP |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (1Z,4E)-1,5-diphenylpenta-1,4-dien-3-one;triphenylphosphane |
| SMILES | O=C(/C=C\c1ccccc1)/C=C/c1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C17H14O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-15H;1-14H/b;13-11-,14-12+ |
| InChIKey | AMOPESIPYPODOC-OYDBFSSJSA-N |
| XLogP | 7.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|