C17H17NO — CID 172776077
azane;1,5-diphenylpenta-1,4-dien-3-one (PubChem CID 172776077) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is azane;1,5-diphenylpenta-1,4-dien-3-one.
| Compound Name | azane;1,5-diphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 172776077 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | azane;1,5-diphenylpenta-1,4-dien-3-one |
| SMILES | N.O=C(C=Cc1ccccc1)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H14O.H3N/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h1-14H;1H3 |
| InChIKey | ZIKVWMRDVZPPHY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|