C11H10O2 — CID 12748773
(1Z,4E)-1-hydroxy-5-phenylpenta-1,4-dien-3-one (PubChem CID 12748773) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1Z,4E)-1-hydroxy-5-phenylpenta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-1-hydroxy-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 12748773 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (1Z,4E)-1-hydroxy-5-phenylpenta-1,4-dien-3-one |
| SMILES | O=C(/C=C\O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H10O2/c12-9-8-11(13)7-6-10-4-2-1-3-5-10/h1-9,12H/b7-6+,9-8- |
| InChIKey | HUANFSPCZZGBNK-MUIOLIGRSA-N |
| XLogP | 2.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|