C18H15Cl3OPd2 — CID 102565376
chloroform;(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;bis(palladium) (PubChem CID 102565376) has the molecular formula C18H15Cl3OPd2 and a molecular weight of 566.52 g/mol. Its IUPAC name is chloroform;(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;bis(palladium).
| Compound Name | chloroform;(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;bis(palladium) |
|---|---|
| PubChem CID | 102565376 |
| Molecular Formula | C18H15Cl3OPd2 |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 563.83 |
| IUPAC Name | chloroform;(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;bis(palladium) |
| SMILES | ClC(Cl)Cl.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.[Pd].[Pd] |
| InChI | InChI=1S/C17H14O.CHCl3.2Pd/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;2-1(3)4;;/h1-14H;1H;;/b13-11+,14-12+;;; |
| InChIKey | NLYJPAJWGANOKG-CXKPDERJSA-N |
| XLogP | 5.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|